C20H25N3 — CID 89357718
2-[(4R)-4-(3-methylidenepyrrolidin-1-yl)azepan-1-yl]quinoline (PubChem CID 89357718) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[(4R)-4-(3-methylidenepyrrolidin-1-yl)azepan-1-yl]quinoline.
| Compound Name | 2-[(4R)-4-(3-methylidenepyrrolidin-1-yl)azepan-1-yl]quinoline |
|---|---|
| PubChem CID | 89357718 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-[(4R)-4-(3-methylidenepyrrolidin-1-yl)azepan-1-yl]quinoline |
| SMILES | C=C1CCN([C@@H]2CCCN(c3ccc4ccccc4n3)CC2)C1 |
| InChI | InChI=1S/C20H25N3/c1-16-10-13-23(15-16)18-6-4-12-22(14-11-18)20-9-8-17-5-2-3-7-19(17)21-20/h2-3,5,7-9,18H,1,4,6,10-15H2/t18-/m1/s1 |
| InChIKey | TVNBTSZDUGSXDH-GOSISDBHSA-N |
| XLogP | 3.86 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|