C19H25N3 — CID 70742061
2-(4-cyclopentyl-1,4-diazepan-1-yl)quinoline (PubChem CID 70742061) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-(4-cyclopentyl-1,4-diazepan-1-yl)quinoline.
| Compound Name | 2-(4-cyclopentyl-1,4-diazepan-1-yl)quinoline |
|---|---|
| PubChem CID | 70742061 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-(4-cyclopentyl-1,4-diazepan-1-yl)quinoline |
| SMILES | c1ccc2nc(N3CCCN(C4CCCC4)CC3)ccc2c1 |
| InChI | InChI=1S/C19H25N3/c1-4-9-18-16(6-1)10-11-19(20-18)22-13-5-12-21(14-15-22)17-7-2-3-8-17/h1,4,6,9-11,17H,2-3,5,7-8,12-15H2 |
| InChIKey | RVXADWODFTXVJZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |