C12H19BrF3NO — CID 112748544
1-[2-(2-bromopropyl)piperidin-1-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 112748544) has the molecular formula C12H19BrF3NO and a molecular weight of 330.19 g/mol. Its IUPAC name is 1-[2-(2-bromopropyl)piperidin-1-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[2-(2-bromopropyl)piperidin-1-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 112748544 |
| Molecular Formula | C12H19BrF3NO |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[2-(2-bromopropyl)piperidin-1-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | CC(Br)CC1CCCCN1C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H19BrF3NO/c1-9(13)8-10-4-2-3-7-17(10)11(18)5-6-12(14,15)16/h9-10H,2-8H2,1H3 |
| InChIKey | PFBKGIGYEVNPBC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|