C10H15ClF3NO — CID 63393880
1-[2-(2-chloroethyl)piperidin-1-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 63393880) has the molecular formula C10H15ClF3NO and a molecular weight of 257.68 g/mol. Its IUPAC name is 1-[2-(2-chloroethyl)piperidin-1-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[2-(2-chloroethyl)piperidin-1-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 63393880 |
| Molecular Formula | C10H15ClF3NO |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 1-[2-(2-chloroethyl)piperidin-1-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCCCC1CCCl |
| InChI | InChI=1S/C10H15ClF3NO/c11-5-4-8-3-1-2-6-15(8)9(16)7-10(12,13)14/h8H,1-7H2 |
| InChIKey | RIGCPRNDDKQWMD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|