C19H23BrN2O3 — CID 112748949
tert-butyl N-[3-[(2-bromo-4-methoxyphenyl)methylamino]phenyl]carbamate (PubChem CID 112748949) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-bromo-4-methoxyphenyl)methylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-bromo-4-methoxyphenyl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 112748949 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | tert-butyl N-[3-[(2-bromo-4-methoxyphenyl)methylamino]phenyl]carbamate |
| SMILES | COc1ccc(CNc2cccc(NC(=O)OC(C)(C)C)c2)c(Br)c1 |
| InChI | InChI=1S/C19H23BrN2O3/c1-19(2,3)25-18(23)22-15-7-5-6-14(10-15)21-12-13-8-9-16(24-4)11-17(13)20/h5-11,21H,12H2,1-4H3,(H,22,23) |
| InChIKey | YNMRHSBNOTZBQD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |