C14H12ClNOS — CID 112749374
4-[(3-chlorothiophen-2-yl)methoxy]-3,5-dimethylbenzonitrile (PubChem CID 112749374) has the molecular formula C14H12ClNOS and a molecular weight of 277.78 g/mol. Its IUPAC name is 4-[(3-chlorothiophen-2-yl)methoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[(3-chlorothiophen-2-yl)methoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 112749374 |
| Molecular Formula | C14H12ClNOS |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 4-[(3-chlorothiophen-2-yl)methoxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCc1sccc1Cl |
| InChI | InChI=1S/C14H12ClNOS/c1-9-5-11(7-16)6-10(2)14(9)17-8-13-12(15)3-4-18-13/h3-6H,8H2,1-2H3 |
| InChIKey | QLGKBPYEXWVUBZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |