C16H15ClN2O — CID 65453921
4-[(2-amino-4-chlorophenyl)methoxy]-3,5-dimethylbenzonitrile (PubChem CID 65453921) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is 4-[(2-amino-4-chlorophenyl)methoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[(2-amino-4-chlorophenyl)methoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 65453921 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-[(2-amino-4-chlorophenyl)methoxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OCc1ccc(Cl)cc1N |
| InChI | InChI=1S/C16H15ClN2O/c1-10-5-12(8-18)6-11(2)16(10)20-9-13-3-4-14(17)7-15(13)19/h3-7H,9,19H2,1-2H3 |
| InChIKey | JTYMYMKVVWSUEA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|