C10H10IN3O3S — CID 112750136
2-iodo-5-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 112750136) has the molecular formula C10H10IN3O3S and a molecular weight of 379.18 g/mol. Its IUPAC name is 2-iodo-5-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-iodo-5-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 112750136 |
| Molecular Formula | C10H10IN3O3S |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 2-iodo-5-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CS(=O)(=O)Cc1noc(-c2ccc(I)c(N)c2)n1 |
| InChI | InChI=1S/C10H10IN3O3S/c1-18(15,16)5-9-13-10(17-14-9)6-2-3-7(11)8(12)4-6/h2-4H,5,12H2,1H3 |
| InChIKey | GAUJUMIWDDUURS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|