C11H11ClIN3O — CID 103211770
1-[5-(3-chloro-4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 103211770) has the molecular formula C11H11ClIN3O and a molecular weight of 363.59 g/mol. Its IUPAC name is 1-[5-(3-chloro-4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
| Compound Name | 1-[5-(3-chloro-4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 103211770 |
| Molecular Formula | C11H11ClIN3O |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 1-[5-(3-chloro-4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CC(N)Cc1noc(-c2ccc(I)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H11ClIN3O/c1-6(14)4-10-15-11(17-16-10)7-2-3-9(13)8(12)5-7/h2-3,5-6H,4,14H2,1H3 |
| InChIKey | QZMZLYIJYJFCLY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|