C11H10F3N3O — CID 63190077
1-[5-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 63190077) has the molecular formula C11H10F3N3O and a molecular weight of 257.22 g/mol. Its IUPAC name is 1-[5-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
| Compound Name | 1-[5-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 63190077 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 1-[5-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CC(N)Cc1noc(-c2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C11H10F3N3O/c1-5(15)2-9-16-11(18-17-9)6-3-7(12)10(14)8(13)4-6/h3-5H,2,15H2,1H3 |
| InChIKey | QGAINMNHRVZEJY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|