C12H14N2O3S — CID 112750606
1-[2-(oxolan-2-yl)ethyl]thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 112750606) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-[2-(oxolan-2-yl)ethyl]thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(oxolan-2-yl)ethyl]thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112750606 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-[2-(oxolan-2-yl)ethyl]thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCC2CCCO2)c2ccsc12 |
| InChI | InChI=1S/C12H14N2O3S/c15-11-10-9(4-7-18-10)14(12(16)13-11)5-3-8-2-1-6-17-8/h4,7-8H,1-3,5-6H2,(H,13,15,16) |
| InChIKey | ZXXCDBTZKGGLJB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |