2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid

C11H14N2O5 — CID 79874687

IUPAC2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid
SMILESO=C(O)c1cn(CCC2CCCO2)c(=O)[nH]c1=O
InChIInChI=1S/C11H14N2O5/c14-9-8(10(15)16)6-13(11(17)12-9)4-3-7-2-1-5-18-7/h6-7H,1-5H2,(H,15,16)(H,12,14,17)
InChIKeyODVLFYBIHMZUJN-UHFFFAOYSA-N
MW254.24 g/mol
LogP-0.20
Rot. Bonds4

About 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid

2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid (PubChem CID 79874687) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid
PubChem CID79874687
Molecular FormulaC11H14N2O5
Molecular Weight254.24 g/mol
Exact Mass254.09
IUPAC Name2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid
SMILESO=C(O)c1cn(CCC2CCCO2)c(=O)[nH]c1=O
InChIInChI=1S/C11H14N2O5/c14-9-8(10(15)16)6-13(11(17)12-9)4-3-7-2-1-5-18-7/h6-7H,1-5H2,(H,15,16)(H,12,14,17)
InChIKeyODVLFYBIHMZUJN-UHFFFAOYSA-N
XLogP-0.20
TPSA101.39 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.24
LogP ≤ 5-0.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid?
The IUPAC name of 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid (CID 79874687) is 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid?
The canonical SMILES for 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid is O=C(O)c1cn(CCC2CCCO2)c(=O)[nH]c1=O.
What is the InChIKey of 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid?
The InChIKey is ODVLFYBIHMZUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O5/c14-9-8(10(15)16)6-13(11(17)12-9)4-3-7-2-1-5-18-7/h6-7H,1-5H2,(H,15,16)(H,12,14,17).
What are the key properties of 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid?
2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid has a molecular weight of 254.24 g/mol, XLogP of -0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-1-[2-(oxolan-2-yl)ethyl]pyrimidine-5-carboxylic acid is sourced from PubChem (CID 79874687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).