C11H15ClN2O4 — CID 97031240
5-chloro-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyrimidine-2,4-dione (PubChem CID 97031240) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is 5-chloro-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 97031240 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-chloro-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCOC[C@H]2CCCO2)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O4/c12-9-6-14(11(16)13-10(9)15)3-5-17-7-8-2-1-4-18-8/h6,8H,1-5,7H2,(H,13,15,16)/t8-/m1/s1 |
| InChIKey | WQVKJEDSNYKMPA-MRVPVSSYSA-N |
| XLogP | 0.39 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|