C8H9ClN2O3 — CID 130575499
5-chloro-1-[2-(oxiran-2-yl)ethyl]pyrimidine-2,4-dione (PubChem CID 130575499) has the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. Its IUPAC name is 5-chloro-1-[2-(oxiran-2-yl)ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[2-(oxiran-2-yl)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 130575499 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 5-chloro-1-[2-(oxiran-2-yl)ethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCC2CO2)cc1Cl |
| InChI | InChI=1S/C8H9ClN2O3/c9-6-3-11(2-1-5-4-14-5)8(13)10-7(6)12/h3,5H,1-2,4H2,(H,10,12,13) |
| InChIKey | AAYHIPHUGATMKR-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|