C10H11ClN4O2 — CID 103744967
5-chloro-1-[2-(1-methylpyrazol-4-yl)ethyl]pyrimidine-2,4-dione (PubChem CID 103744967) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is 5-chloro-1-[2-(1-methylpyrazol-4-yl)ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[2-(1-methylpyrazol-4-yl)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 103744967 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5-chloro-1-[2-(1-methylpyrazol-4-yl)ethyl]pyrimidine-2,4-dione |
| SMILES | Cn1cc(CCn2cc(Cl)c(=O)[nH]c2=O)cn1 |
| InChI | InChI=1S/C10H11ClN4O2/c1-14-5-7(4-12-14)2-3-15-6-8(11)9(16)13-10(15)17/h4-6H,2-3H2,1H3,(H,13,16,17) |
| InChIKey | GXJCSRJXHZSUQM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |