C24H46N2O7 — CID 14910693
10,13-bis[2-(oxolan-2-ylmethoxy)ethyl]-1,4,7-trioxa-10,13-diazacyclopentadecane (PubChem CID 14910693) has the molecular formula C24H46N2O7 and a molecular weight of 474.64 g/mol. Its IUPAC name is 10,13-bis[2-(oxolan-2-ylmethoxy)ethyl]-1,4,7-trioxa-10,13-diazacyclopentadecane.
| Compound Name | 10,13-bis[2-(oxolan-2-ylmethoxy)ethyl]-1,4,7-trioxa-10,13-diazacyclopentadecane |
|---|---|
| PubChem CID | 14910693 |
| Molecular Formula | C24H46N2O7 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | 10,13-bis[2-(oxolan-2-ylmethoxy)ethyl]-1,4,7-trioxa-10,13-diazacyclopentadecane |
| SMILES | C1COC(COCCN2CCOCCOCCOCCN(CCOCC3CCCO3)CC2)C1 |
| InChI | InChI=1S/C24H46N2O7/c1-3-23(32-11-1)21-30-15-9-25-5-6-26(10-16-31-22-24-4-2-12-33-24)8-14-28-18-20-29-19-17-27-13-7-25/h23-24H,1-22H2 |
| InChIKey | ARSFHCAJCPGTGB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|