C15H25N3O2 — CID 98768010
(3S)-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-3-(1H-pyrazol-5-yl)piperidine (PubChem CID 98768010) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (3S)-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-3-(1H-pyrazol-5-yl)piperidine.
| Compound Name | (3S)-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-3-(1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 98768010 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (3S)-1-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-3-(1H-pyrazol-5-yl)piperidine |
| SMILES | c1cc([C@H]2CCCN(CCOC[C@H]3CCCO3)C2)[nH]n1 |
| InChI | InChI=1S/C15H25N3O2/c1-3-13(15-5-6-16-17-15)11-18(7-1)8-10-19-12-14-4-2-9-20-14/h5-6,13-14H,1-4,7-12H2,(H,16,17)/t13-,14+/m0/s1 |
| InChIKey | WMXZNDFOAFMUSG-UONOGXRCSA-N |
| XLogP | 1.78 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|