C12H19BN2O5S — CID 112752058
[4-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethoxy]phenyl]boronic acid (PubChem CID 112752058) has the molecular formula C12H19BN2O5S and a molecular weight of 314.17 g/mol. Its IUPAC name is [4-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethoxy]phenyl]boronic acid.
| Compound Name | [4-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 112752058 |
| Molecular Formula | C12H19BN2O5S |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [4-[2-(5-ethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethoxy]phenyl]boronic acid |
| SMILES | CCN1CCN(CCOc2ccc(B(O)O)cc2)S1(=O)=O |
| InChI | InChI=1S/C12H19BN2O5S/c1-2-14-7-8-15(21(14,18)19)9-10-20-12-5-3-11(4-6-12)13(16)17/h3-6,16-17H,2,7-10H2,1H3 |
| InChIKey | RKDSQWGJFYEAID-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|