C12H26N2O3 — CID 112752590
2-(3,3-dimethylmorpholin-4-yl)-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 112752590) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(3,3-dimethylmorpholin-4-yl)-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | 2-(3,3-dimethylmorpholin-4-yl)-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 112752590 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 2-(3,3-dimethylmorpholin-4-yl)-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCC(CN)N1CCOCC1(C)C |
| InChI | InChI=1S/C12H26N2O3/c1-12(2)10-17-5-4-14(12)11(8-13)9-16-7-6-15-3/h11H,4-10,13H2,1-3H3 |
| InChIKey | RVAXEOFTZGHKEW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|