C11H24N2O2 — CID 62476464
1-(3,3-dimethylmorpholin-4-yl)-4-methoxybutan-2-amine (PubChem CID 62476464) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(3,3-dimethylmorpholin-4-yl)-4-methoxybutan-2-amine.
| Compound Name | 1-(3,3-dimethylmorpholin-4-yl)-4-methoxybutan-2-amine |
|---|---|
| PubChem CID | 62476464 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1-(3,3-dimethylmorpholin-4-yl)-4-methoxybutan-2-amine |
| SMILES | COCCC(N)CN1CCOCC1(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-11(2)9-15-7-5-13(11)8-10(12)4-6-14-3/h10H,4-9,12H2,1-3H3 |
| InChIKey | YGGMCXBBPKTMRN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |