C11H15IN4OS — CID 112755592
1-(5-iodo-1,3-thiazol-2-yl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol (PubChem CID 112755592) has the molecular formula C11H15IN4OS and a molecular weight of 378.24 g/mol. Its IUPAC name is 1-(5-iodo-1,3-thiazol-2-yl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol.
| Compound Name | 1-(5-iodo-1,3-thiazol-2-yl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol |
|---|---|
| PubChem CID | 112755592 |
| Molecular Formula | C11H15IN4OS |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 1-(5-iodo-1,3-thiazol-2-yl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethanol |
| SMILES | CC(C)Cn1ncnc1CC(O)c1ncc(I)s1 |
| InChI | InChI=1S/C11H15IN4OS/c1-7(2)5-16-10(14-6-15-16)3-8(17)11-13-4-9(12)18-11/h4,6-8,17H,3,5H2,1-2H3 |
| InChIKey | WRQNLADHOYAWHP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|