C10H13ClN4O2 — CID 112756295
3-amino-6-methoxy-1H-indole-2-carbohydrazide;hydrochloride (PubChem CID 112756295) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 3-amino-6-methoxy-1H-indole-2-carbohydrazide;hydrochloride.
| Compound Name | 3-amino-6-methoxy-1H-indole-2-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 112756295 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-amino-6-methoxy-1H-indole-2-carbohydrazide;hydrochloride |
| SMILES | COc1ccc2c(N)c(C(=O)NN)[nH]c2c1.Cl |
| InChI | InChI=1S/C10H12N4O2.ClH/c1-16-5-2-3-6-7(4-5)13-9(8(6)11)10(15)14-12;/h2-4,13H,11-12H2,1H3,(H,14,15);1H |
| InChIKey | VTFMJGZVEMXANH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|