C10H17N3O3 — CID 112757661
(2R,5S)-5-(piperazine-1-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 112757661) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2R,5S)-5-(piperazine-1-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,5S)-5-(piperazine-1-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 112757661 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (2R,5S)-5-(piperazine-1-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@@H](C(=O)N2CCNCC2)N1 |
| InChI | InChI=1S/C10H17N3O3/c14-9(13-5-3-11-4-6-13)7-1-2-8(12-7)10(15)16/h7-8,11-12H,1-6H2,(H,15,16)/t7-,8+/m0/s1 |
| InChIKey | BSEKVSKXNUMJLY-JGVFFNPUSA-N |
| XLogP | -1.38 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |