C9H16FN3O — CID 130978967
[(2R,4S)-4-fluoropyrrolidin-2-yl]-piperazin-1-ylmethanone (PubChem CID 130978967) has the molecular formula C9H16FN3O and a molecular weight of 201.24 g/mol. Its IUPAC name is [(2R,4S)-4-fluoropyrrolidin-2-yl]-piperazin-1-ylmethanone.
| Compound Name | [(2R,4S)-4-fluoropyrrolidin-2-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 130978967 |
| Molecular Formula | C9H16FN3O |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | [(2R,4S)-4-fluoropyrrolidin-2-yl]-piperazin-1-ylmethanone |
| SMILES | O=C([C@H]1C[C@H](F)CN1)N1CCNCC1 |
| InChI | InChI=1S/C9H16FN3O/c10-7-5-8(12-6-7)9(14)13-3-1-11-2-4-13/h7-8,11-12H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | HXGHMTHKZTYSCL-JGVFFNPUSA-N |
| XLogP | -0.88 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |