C12H16N2OS2 — CID 112758937
N-(1-pyridin-2-ylethyl)-1,4-dithiane-2-carboxamide (PubChem CID 112758937) has the molecular formula C12H16N2OS2 and a molecular weight of 268.41 g/mol. Its IUPAC name is N-(1-pyridin-2-ylethyl)-1,4-dithiane-2-carboxamide.
| Compound Name | N-(1-pyridin-2-ylethyl)-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 112758937 |
| Molecular Formula | C12H16N2OS2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(1-pyridin-2-ylethyl)-1,4-dithiane-2-carboxamide |
| SMILES | CC(NC(=O)C1CSCCS1)c1ccccn1 |
| InChI | InChI=1S/C12H16N2OS2/c1-9(10-4-2-3-5-13-10)14-12(15)11-8-16-6-7-17-11/h2-5,9,11H,6-8H2,1H3,(H,14,15) |
| InChIKey | BNLQHDKZRWBFEI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |