C23H21F3N4O4 — CID 1127594
(5S,7S)-5-(1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1127594) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is (5S,7S)-5-(1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-5-(1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1127594 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (5S,7S)-5-(1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cnn3c2N[C@H](c2ccc4c(c2)OCO4)C[C@H]3C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3N4O4/c1-32-15-5-2-13(3-6-15)10-27-22(31)16-11-28-30-20(23(24,25)26)9-17(29-21(16)30)14-4-7-18-19(8-14)34-12-33-18/h2-8,11,17,20,29H,9-10,12H2,1H3,(H,27,31)/t17-,20-/m0/s1 |
| InChIKey | QDQVQXKCJRMEPV-PXNSSMCTSA-N |
| XLogP | 4.21 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |