C19H23F3N4O2 — CID 135730380
(5S,7S)-5-(4-ethylphenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 135730380) has the molecular formula C19H23F3N4O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is (5S,7S)-5-(4-ethylphenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-5-(4-ethylphenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 135730380 |
| Molecular Formula | C19H23F3N4O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (5S,7S)-5-(4-ethylphenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCc1ccc([C@@H]2C[C@@H](C(F)(F)F)n3ncc(C(=O)NCCOC)c3N2)cc1 |
| InChI | InChI=1S/C19H23F3N4O2/c1-3-12-4-6-13(7-5-12)15-10-16(19(20,21)22)26-17(25-15)14(11-24-26)18(27)23-8-9-28-2/h4-7,11,15-16,25H,3,8-10H2,1-2H3,(H,23,27)/t15-,16-/m0/s1 |
| InChIKey | NLZKYEGZSHQDDE-HOTGVXAUSA-N |
| XLogP | 3.48 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|