C21H23F3N6O2 — CID 136780708
(5R,7R)-N-(3-imidazol-1-ylpropyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136780708) has the molecular formula C21H23F3N6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is (5R,7R)-N-(3-imidazol-1-ylpropyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7R)-N-(3-imidazol-1-ylpropyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136780708 |
| Molecular Formula | C21H23F3N6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (5R,7R)-N-(3-imidazol-1-ylpropyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@H](C(F)(F)F)n3ncc(C(=O)NCCCn4ccnc4)c3N2)cc1 |
| InChI | InChI=1S/C21H23F3N6O2/c1-32-15-5-3-14(4-6-15)17-11-18(21(22,23)24)30-19(28-17)16(12-27-30)20(31)26-7-2-9-29-10-8-25-13-29/h3-6,8,10,12-13,17-18,28H,2,7,9,11H2,1H3,(H,26,31)/t17-,18-/m1/s1 |
| InChIKey | VNWPAHHRXQZSNJ-QZTJIDSGSA-N |
| XLogP | 3.57 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|