C20H29NO4 — CID 112759477
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-ethylhexyl)-4-oxobutanamide (PubChem CID 112759477) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-ethylhexyl)-4-oxobutanamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-ethylhexyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 112759477 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-ethylhexyl)-4-oxobutanamide |
| SMILES | CCCCC(CC)CNC(=O)CCC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H29NO4/c1-3-5-6-15(4-2)14-21-20(23)10-8-17(22)16-7-9-18-19(13-16)25-12-11-24-18/h7,9,13,15H,3-6,8,10-12,14H2,1-2H3,(H,21,23) |
| InChIKey | KTLXHNQXFJJIST-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |