C16H23BrN2O2 — CID 112760030
4-(3-bromophenoxy)-1-(4-ethylpiperazin-1-yl)butan-1-one (PubChem CID 112760030) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 4-(3-bromophenoxy)-1-(4-ethylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-(3-bromophenoxy)-1-(4-ethylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 112760030 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-(3-bromophenoxy)-1-(4-ethylpiperazin-1-yl)butan-1-one |
| SMILES | CCN1CCN(C(=O)CCCOc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-2-18-8-10-19(11-9-18)16(20)7-4-12-21-15-6-3-5-14(17)13-15/h3,5-6,13H,2,4,7-12H2,1H3 |
| InChIKey | CTCGEQDWVAWYAN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|