C19H24BrN3O2S — CID 55683830
4-(3-bromophenoxy)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butan-1-one (PubChem CID 55683830) has the molecular formula C19H24BrN3O2S and a molecular weight of 438.39 g/mol. Its IUPAC name is 4-(3-bromophenoxy)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(3-bromophenoxy)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55683830 |
| Molecular Formula | C19H24BrN3O2S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 4-(3-bromophenoxy)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1nc(CN2CCN(C(=O)CCCOc3cccc(Br)c3)CC2)cs1 |
| InChI | InChI=1S/C19H24BrN3O2S/c1-15-21-17(14-26-15)13-22-7-9-23(10-8-22)19(24)6-3-11-25-18-5-2-4-16(20)12-18/h2,4-5,12,14H,3,6-11,13H2,1H3 |
| InChIKey | ZMMMZVXUAYRAPO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|