C22H28N4O2S — CID 47041147
(6-butoxy-1H-indol-2-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 47041147) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is (6-butoxy-1H-indol-2-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (6-butoxy-1H-indol-2-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 47041147 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (6-butoxy-1H-indol-2-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | CCCCOc1ccc2cc(C(=O)N3CCN(Cc4csc(C)n4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C22H28N4O2S/c1-3-4-11-28-19-6-5-17-12-21(24-20(17)13-19)22(27)26-9-7-25(8-10-26)14-18-15-29-16(2)23-18/h5-6,12-13,15,24H,3-4,7-11,14H2,1-2H3 |
| InChIKey | ICZLCPIBGRQRMA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|