C24H31NO3 — CID 112762986
4-(4-acetylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]butanamide (PubChem CID 112762986) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 112762986 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-[2,6-di(propan-2-yl)phenyl]butanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)Nc2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-16(2)21-8-6-9-22(17(3)4)24(21)25-23(27)10-7-15-28-20-13-11-19(12-14-20)18(5)26/h6,8-9,11-14,16-17H,7,10,15H2,1-5H3,(H,25,27) |
| InChIKey | CPWOCZFQOXTSPB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|