C24H33NO2 — CID 7790411
4-(4-tert-butylphenoxy)-N-(2-methyl-6-propan-2-ylphenyl)butanamide (PubChem CID 7790411) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-(2-methyl-6-propan-2-ylphenyl)butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-(2-methyl-6-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 7790411 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-(2-methyl-6-propan-2-ylphenyl)butanamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H33NO2/c1-17(2)21-10-7-9-18(3)23(21)25-22(26)11-8-16-27-20-14-12-19(13-15-20)24(4,5)6/h7,9-10,12-15,17H,8,11,16H2,1-6H3,(H,25,26) |
| InChIKey | APOBFIQTDQEJKB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|