C23H35N3O3 — CID 112763209
4-tert-butyl-N-[3-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]butan-2-yl]benzamide (PubChem CID 112763209) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]butan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 112763209 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 4-tert-butyl-N-[3-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NCCCN1CCCC1=O |
| InChI | InChI=1S/C23H35N3O3/c1-16(2)20(22(29)24-13-7-15-26-14-6-8-19(26)27)25-21(28)17-9-11-18(12-10-17)23(3,4)5/h9-12,16,20H,6-8,13-15H2,1-5H3,(H,24,29)(H,25,28) |
| InChIKey | BQPKPNRSJXSDNU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|