C21H32N4O3S — CID 112763595
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]acetamide (PubChem CID 112763595) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 112763595 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NCC(c2cccs2)N2CCC(C)CC2)C1=O |
| InChI | InChI=1S/C21H32N4O3S/c1-4-21(5-2)19(27)25(20(28)23-21)14-18(26)22-13-16(17-7-6-12-29-17)24-10-8-15(3)9-11-24/h6-7,12,15-16H,4-5,8-11,13-14H2,1-3H3,(H,22,26)(H,23,28) |
| InChIKey | KWFJSWSISRZJIZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|