C27H29N3O2S — CID 46603423
N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 46603423) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 46603423 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CC1CCN(C(CNC(=O)Cn2c3ccccc3c(=O)c3ccccc32)c2cccs2)CC1 |
| InChI | InChI=1S/C27H29N3O2S/c1-19-12-14-29(15-13-19)24(25-11-6-16-33-25)17-28-26(31)18-30-22-9-4-2-7-20(22)27(32)21-8-3-5-10-23(21)30/h2-11,16,19,24H,12-15,17-18H2,1H3,(H,28,31) |
| InChIKey | LWLVOCIEXYNDFN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|