C26H28N4OS — CID 112765124
3-(1-phenylbenzimidazol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)propanamide (PubChem CID 112765124) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-(1-phenylbenzimidazol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-(1-phenylbenzimidazol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 112765124 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-(1-phenylbenzimidazol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)propanamide |
| SMILES | O=C(CCc1nc2ccccc2n1-c1ccccc1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C26H28N4OS/c31-26(27-19-23(24-13-8-18-32-24)29-16-6-7-17-29)15-14-25-28-21-11-4-5-12-22(21)30(25)20-9-2-1-3-10-20/h1-5,8-13,18,23H,6-7,14-17,19H2,(H,27,31) |
| InChIKey | CPQRFOHTHLCJNJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |