C13H23NOS — CID 11276537
(2S)-2-cyclohexylsulfanyl-N,N-dimethylpent-4-enamide (PubChem CID 11276537) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is (2S)-2-cyclohexylsulfanyl-N,N-dimethylpent-4-enamide.
| Compound Name | (2S)-2-cyclohexylsulfanyl-N,N-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 11276537 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (2S)-2-cyclohexylsulfanyl-N,N-dimethylpent-4-enamide |
| SMILES | C=CC[C@H](SC1CCCCC1)C(=O)N(C)C |
| InChI | InChI=1S/C13H23NOS/c1-4-8-12(13(15)14(2)3)16-11-9-6-5-7-10-11/h4,11-12H,1,5-10H2,2-3H3/t12-/m0/s1 |
| InChIKey | YQLSGFPDQIKLON-LBPRGKRZSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|