C22H28ClN3O3 — CID 112767128
1-(2-chlorophenyl)-4-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 112767128) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(2-chlorophenyl)-4-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 112767128 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-(2-chlorophenyl)-4-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C(C1CCN(C(=O)C2CC(=O)N(c3ccccc3Cl)C2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C22H28ClN3O3/c23-18-6-2-3-7-19(18)26-15-17(14-20(26)27)22(29)25-12-8-16(9-13-25)21(28)24-10-4-1-5-11-24/h2-3,6-7,16-17H,1,4-5,8-15H2 |
| InChIKey | QXCSWSQXLBOASR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |