C25H25ClN4O3S — CID 112767820
3-[(3-chlorophenyl)-methylsulfamoyl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide (PubChem CID 112767820) has the molecular formula C25H25ClN4O3S and a molecular weight of 497.02 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)-methylsulfamoyl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide.
| Compound Name | 3-[(3-chlorophenyl)-methylsulfamoyl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 112767820 |
| Molecular Formula | C25H25ClN4O3S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 3-[(3-chlorophenyl)-methylsulfamoyl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)c1cccc(S(=O)(=O)N(C)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C25H25ClN4O3S/c1-18-28-23-12-3-4-13-24(23)30(18)15-7-14-27-25(31)19-8-5-11-22(16-19)34(32,33)29(2)21-10-6-9-20(26)17-21/h3-6,8-13,16-17H,7,14-15H2,1-2H3,(H,27,31) |
| InChIKey | CFVFEBZHPURINI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|