C13H15NO5 — CID 11277080
dimethyl (3S,4R,5S)-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate (PubChem CID 11277080) has the molecular formula C13H15NO5 and a molecular weight of 265.27 g/mol. Its IUPAC name is dimethyl (3S,4R,5S)-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate.
| Compound Name | dimethyl (3S,4R,5S)-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11277080 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | dimethyl (3S,4R,5S)-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C(=O)OC)ON[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H15NO5/c1-17-12(15)9-10(8-6-4-3-5-7-8)14-19-11(9)13(16)18-2/h3-7,9-11,14H,1-2H3/t9-,10-,11+/m1/s1 |
| InChIKey | WISLPTLIZHUNSH-MXWKQRLJSA-N |
| XLogP | 0.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |