methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate

C13H17NO4 — CID 11543346

IUPACmethyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate
SMILESCOC(=O)[C@@]1(OC)C[C@@H](Cc2ccccc2)NO1
InChIInChI=1S/C13H17NO4/c1-16-12(15)13(17-2)9-11(14-18-13)8-10-6-4-3-5-7-10/h3-7,11,14H,8-9H2,1-2H3/t11-,13-/m1/s1
InChIKeyCEDOILMBNQLUSD-DGCLKSJQSA-N
MW251.28 g/mol
LogP1.04
Rot. Bonds4

About methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate

methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate (PubChem CID 11543346) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate.

Molecular Properties

Compound Namemethyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate
PubChem CID11543346
Molecular FormulaC13H17NO4
Molecular Weight251.28 g/mol
Exact Mass251.12
IUPAC Namemethyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate
SMILESCOC(=O)[C@@]1(OC)C[C@@H](Cc2ccccc2)NO1
InChIInChI=1S/C13H17NO4/c1-16-12(15)13(17-2)9-11(14-18-13)8-10-6-4-3-5-7-10/h3-7,11,14H,8-9H2,1-2H3/t11-,13-/m1/s1
InChIKeyCEDOILMBNQLUSD-DGCLKSJQSA-N
XLogP1.04
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.28
LogP ≤ 51.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate?
The IUPAC name of methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate (CID 11543346) is methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate.
What is the SMILES notation for methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate?
The canonical SMILES for methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate is COC(=O)[C@@]1(OC)C[C@@H](Cc2ccccc2)NO1.
What is the InChIKey of methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate?
The InChIKey is CEDOILMBNQLUSD-DGCLKSJQSA-N. The full InChI is InChI=1S/C13H17NO4/c1-16-12(15)13(17-2)9-11(14-18-13)8-10-6-4-3-5-7-10/h3-7,11,14H,8-9H2,1-2H3/t11-,13-/m1/s1.
What are the key properties of methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate?
methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate has a molecular weight of 251.28 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,5R)-3-benzyl-5-methoxy-1,2-oxazolidine-5-carboxylate is sourced from PubChem (CID 11543346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).