C26H25N3O3 — CID 112772180
1-benzyl-N-(2-methoxy-5-methylphenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide (PubChem CID 112772180) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-benzyl-N-(2-methoxy-5-methylphenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(2-methoxy-5-methylphenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 112772180 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-benzyl-N-(2-methoxy-5-methylphenyl)-3-(3-methoxyphenyl)pyrazole-4-carboxamide |
| SMILES | COc1cccc(-c2nn(Cc3ccccc3)cc2C(=O)Nc2cc(C)ccc2OC)c1 |
| InChI | InChI=1S/C26H25N3O3/c1-18-12-13-24(32-3)23(14-18)27-26(30)22-17-29(16-19-8-5-4-6-9-19)28-25(22)20-10-7-11-21(15-20)31-2/h4-15,17H,16H2,1-3H3,(H,27,30) |
| InChIKey | HZJMQPWZEJLWEY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |