C28H27N3O4 — CID 55512860
methyl 4-[2-[[1-benzyl-3-(3-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]benzoate (PubChem CID 55512860) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is methyl 4-[2-[[1-benzyl-3-(3-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[[1-benzyl-3-(3-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 55512860 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | methyl 4-[2-[[1-benzyl-3-(3-methoxyphenyl)pyrazole-4-carbonyl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCNC(=O)c2cn(Cc3ccccc3)nc2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C28H27N3O4/c1-34-24-10-6-9-23(17-24)26-25(19-31(30-26)18-21-7-4-3-5-8-21)27(32)29-16-15-20-11-13-22(14-12-20)28(33)35-2/h3-14,17,19H,15-16,18H2,1-2H3,(H,29,32) |
| InChIKey | BUPGYVILHLZLJX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |