C28H30N4O2 — CID 42916251
1-benzyl-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-phenylpyrazole-4-carboxamide (PubChem CID 42916251) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 1-benzyl-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-phenylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42916251 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-benzyl-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-phenylpyrazole-4-carboxamide |
| SMILES | COc1cccc(C(CNC(=O)c2cn(Cc3ccccc3)nc2-c2ccccc2)N(C)C)c1 |
| InChI | InChI=1S/C28H30N4O2/c1-31(2)26(23-15-10-16-24(17-23)34-3)18-29-28(33)25-20-32(19-21-11-6-4-7-12-21)30-27(25)22-13-8-5-9-14-22/h4-17,20,26H,18-19H2,1-3H3,(H,29,33) |
| InChIKey | XRSGMRIRLBCAHT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |