C21H22N2O2S2 — CID 112773870
3-methyl-2-(4-oxo-4-phenylbutyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 112773870) has the molecular formula C21H22N2O2S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-methyl-2-(4-oxo-4-phenylbutyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-(4-oxo-4-phenylbutyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 112773870 |
| Molecular Formula | C21H22N2O2S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-methyl-2-(4-oxo-4-phenylbutyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cn1c(SCCCC(=O)c2ccccc2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C21H22N2O2S2/c1-23-20(25)18-15-10-5-6-12-17(15)27-19(18)22-21(23)26-13-7-11-16(24)14-8-3-2-4-9-14/h2-4,8-9H,5-7,10-13H2,1H3 |
| InChIKey | MLKSWTPNJVTKOL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|