C20H20N4O3S2 — CID 3325043
N'-[2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 3325043) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N'-[2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 3325043 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N'-[2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | Cn1c(SCC(=O)NNC(=O)c2ccccc2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C20H20N4O3S2/c1-24-19(27)16-13-9-5-6-10-14(13)29-18(16)21-20(24)28-11-15(25)22-23-17(26)12-7-3-2-4-8-12/h2-4,7-8H,5-6,9-11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | AVSMWNMPFXYKJP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|