C24H25N5O2S2 — CID 112773866
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 112773866) has the molecular formula C24H25N5O2S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 112773866 |
| Molecular Formula | C24H25N5O2S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(3-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)CSc1nc2sc3c(c2c(=O)n1C)CCCC3 |
| InChI | InChI=1S/C24H25N5O2S2/c1-14-21(15(2)29(27-14)16-9-5-4-6-10-16)25-19(30)13-32-24-26-22-20(23(31)28(24)3)17-11-7-8-12-18(17)33-22/h4-6,9-10H,7-8,11-13H2,1-3H3,(H,25,30) |
| InChIKey | NVGOTPAPGQVAGA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |