C28H29N3O2S2 — CID 3135507
N-(2,6-diethylphenyl)-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 3135507) has the molecular formula C28H29N3O2S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3135507 |
| Molecular Formula | C28H29N3O2S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCCC3 |
| InChI | InChI=1S/C28H29N3O2S2/c1-3-18-11-10-12-19(4-2)25(18)29-23(32)17-34-28-30-26-24(21-15-8-9-16-22(21)35-26)27(33)31(28)20-13-6-5-7-14-20/h5-7,10-14H,3-4,8-9,15-17H2,1-2H3,(H,29,32) |
| InChIKey | KSIDJWOCQOJZKI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |